C27H24ClN3O7S — CID 19661797
methyl 2-[[2-[(2E)-2-[1-[4-(3-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19661797) has the molecular formula C27H24ClN3O7S and a molecular weight of 570.02 g/mol. Its IUPAC name is methyl 2-[[2-[(2E)-2-[1-[4-(3-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(2E)-2-[1-[4-(3-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19661797 |
| Molecular Formula | C27H24ClN3O7S |
| Molecular Weight | 570.02 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | methyl 2-[[2-[(2E)-2-[1-[4-(3-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(=O)N/N=C(\C)c2ccc(OC(=O)c3cccc(Cl)c3)c(OC)c2)sc2c1CCC2 |
| InChI | InChI=1S/C27H24ClN3O7S/c1-14(15-10-11-19(20(13-15)36-2)38-26(34)16-6-4-7-17(28)12-16)30-31-24(33)23(32)29-25-22(27(35)37-3)18-8-5-9-21(18)39-25/h4,6-7,10-13H,5,8-9H2,1-3H3,(H,29,32)(H,31,33)/b30-14+ |
| InChIKey | TWMHLCHZEHSSNW-AMVVHIIESA-N |
| XLogP | 4.38 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.02 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|