C27H26ClN3O6S — CID 5006934
methyl 2-[[2-[2-[1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 5006934) has the molecular formula C27H26ClN3O6S and a molecular weight of 556.04 g/mol. Its IUPAC name is methyl 2-[[2-[2-[1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[2-[1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 5006934 |
| Molecular Formula | C27H26ClN3O6S |
| Molecular Weight | 556.04 g/mol |
| Exact Mass | 555.12 |
| IUPAC Name | methyl 2-[[2-[2-[1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(=O)NN=C(C)c2ccc(OCc3ccc(Cl)cc3)c(OC)c2)sc2c1CCC2 |
| InChI | InChI=1S/C27H26ClN3O6S/c1-15(17-9-12-20(21(13-17)35-2)37-14-16-7-10-18(28)11-8-16)30-31-25(33)24(32)29-26-23(27(34)36-3)19-5-4-6-22(19)38-26/h7-13H,4-6,14H2,1-3H3,(H,29,32)(H,31,33) |
| InChIKey | ACLMABDSYMSKCZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|