C21H19BrN4O2 — CID 19659135
N-(4-bromo-2-methylphenyl)-N'-[(E)-1-(4-pyrrol-1-ylphenyl)ethylideneamino]oxamide (PubChem CID 19659135) has the molecular formula C21H19BrN4O2 and a molecular weight of 439.31 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-N'-[(E)-1-(4-pyrrol-1-ylphenyl)ethylideneamino]oxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-N'-[(E)-1-(4-pyrrol-1-ylphenyl)ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19659135 |
| Molecular Formula | C21H19BrN4O2 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-N'-[(E)-1-(4-pyrrol-1-ylphenyl)ethylideneamino]oxamide |
| SMILES | C/C(=N\NC(=O)C(=O)Nc1ccc(Br)cc1C)c1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C21H19BrN4O2/c1-14-13-17(22)7-10-19(14)23-20(27)21(28)25-24-15(2)16-5-8-18(9-6-16)26-11-3-4-12-26/h3-13H,1-2H3,(H,23,27)(H,25,28)/b24-15+ |
| InChIKey | JCBNDUUPFAWRNI-BUVRLJJBSA-N |
| XLogP | 4.03 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|