C15H12BrFN4O2 — CID 3252551
N-(4-bromo-2-fluorophenyl)-N'-(1-pyridin-4-ylethylideneamino)oxamide (PubChem CID 3252551) has the molecular formula C15H12BrFN4O2 and a molecular weight of 379.19 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-N'-(1-pyridin-4-ylethylideneamino)oxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-N'-(1-pyridin-4-ylethylideneamino)oxamide |
|---|---|
| PubChem CID | 3252551 |
| Molecular Formula | C15H12BrFN4O2 |
| Molecular Weight | 379.19 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-N'-(1-pyridin-4-ylethylideneamino)oxamide |
| SMILES | CC(=NNC(=O)C(=O)Nc1ccc(Br)cc1F)c1ccncc1 |
| InChI | InChI=1S/C15H12BrFN4O2/c1-9(10-4-6-18-7-5-10)20-21-15(23)14(22)19-13-3-2-11(16)8-12(13)17/h2-8H,1H3,(H,19,22)(H,21,23) |
| InChIKey | OXLCYUMRVPNYMQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.19 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|