C14H12ClN3O2S — CID 19660564
N-(2-chlorophenyl)-N'-[(E)-1-thiophen-2-ylethylideneamino]oxamide (PubChem CID 19660564) has the molecular formula C14H12ClN3O2S and a molecular weight of 321.79 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(E)-1-thiophen-2-ylethylideneamino]oxamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(E)-1-thiophen-2-ylethylideneamino]oxamide |
|---|---|
| PubChem CID | 19660564 |
| Molecular Formula | C14H12ClN3O2S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(E)-1-thiophen-2-ylethylideneamino]oxamide |
| SMILES | C/C(=N\NC(=O)C(=O)Nc1ccccc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H12ClN3O2S/c1-9(12-7-4-8-21-12)17-18-14(20)13(19)16-11-6-3-2-5-10(11)15/h2-8H,1H3,(H,16,19)(H,18,20)/b17-9+ |
| InChIKey | ZGYZIQUDRQGNQL-RQZCQDPDSA-N |
| XLogP | 2.88 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|