C14H18ClN3O2 — CID 94846586
N-(2-chlorophenyl)-N'-[(Z)-hexan-2-ylideneamino]oxamide (PubChem CID 94846586) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(Z)-hexan-2-ylideneamino]oxamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(Z)-hexan-2-ylideneamino]oxamide |
|---|---|
| PubChem CID | 94846586 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(Z)-hexan-2-ylideneamino]oxamide |
| SMILES | CCCC/C(C)=N\NC(=O)C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H18ClN3O2/c1-3-4-7-10(2)17-18-14(20)13(19)16-12-9-6-5-8-11(12)15/h5-6,8-9H,3-4,7H2,1-2H3,(H,16,19)(H,18,20)/b17-10- |
| InChIKey | JMUSLWWXPVCNRW-YVLHZVERSA-N |
| XLogP | 2.96 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|