C15H12F3N3O2S — CID 19659603
N'-[(E)-1-thiophen-2-ylethylideneamino]-N-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 19659603) has the molecular formula C15H12F3N3O2S and a molecular weight of 355.34 g/mol. Its IUPAC name is N'-[(E)-1-thiophen-2-ylethylideneamino]-N-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[(E)-1-thiophen-2-ylethylideneamino]-N-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 19659603 |
| Molecular Formula | C15H12F3N3O2S |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | N'-[(E)-1-thiophen-2-ylethylideneamino]-N-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | C/C(=N\NC(=O)C(=O)Nc1ccc(C(F)(F)F)cc1)c1cccs1 |
| InChI | InChI=1S/C15H12F3N3O2S/c1-9(12-3-2-8-24-12)20-21-14(23)13(22)19-11-6-4-10(5-7-11)15(16,17)18/h2-8H,1H3,(H,19,22)(H,21,23)/b20-9+ |
| InChIKey | DKUBLOFUWNYSBL-AWQFTUOYSA-N |
| XLogP | 3.25 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|