C30H23N3O3S — CID 18830508
N-[4-[(E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide (PubChem CID 18830508) has the molecular formula C30H23N3O3S and a molecular weight of 505.60 g/mol. Its IUPAC name is N-[4-[(E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[(E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18830508 |
| Molecular Formula | C30H23N3O3S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-[4-[(E)-3-[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]prop-2-enoyl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2/C=C/C(=O)c2ccc(NC(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C30H23N3O3S/c1-36-26-16-11-22(12-17-26)29-23(20-33(32-29)25-6-3-2-4-7-25)13-18-27(34)21-9-14-24(15-10-21)31-30(35)28-8-5-19-37-28/h2-20H,1H3,(H,31,35)/b18-13+ |
| InChIKey | GYMLCFBYNNMVCQ-QGOAFFKASA-N |
| XLogP | 6.76 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|