C26H21N3O4 — CID 76877718
methyl 2-[4-[3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enoyl]phenoxy]acetate (PubChem CID 76877718) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is methyl 2-[4-[3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enoyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enoyl]phenoxy]acetate |
|---|---|
| PubChem CID | 76877718 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | methyl 2-[4-[3-(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)prop-2-enoyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)C=Cc2cn(-c3ccccc3)nc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C26H21N3O4/c1-32-25(31)18-33-23-10-7-19(8-11-23)24(30)12-9-21-17-29(22-5-3-2-4-6-22)28-26(21)20-13-15-27-16-14-20/h2-17H,18H2,1H3 |
| InChIKey | RXUVFPXTRRLOPW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|