C26H20N2O6 — CID 97424187
(1,3-dioxoisoindol-2-yl)methyl 2-[[(Z)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 97424187) has the molecular formula C26H20N2O6 and a molecular weight of 456.45 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-[[(Z)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-[[(Z)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 97424187 |
| Molecular Formula | C26H20N2O6 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-[[(Z)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | COc1ccc(/C=C\C(=O)Nc2ccccc2C(=O)OCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H20N2O6/c1-33-18-13-10-17(11-14-18)12-15-23(29)27-22-9-5-4-8-21(22)26(32)34-16-28-24(30)19-6-2-3-7-20(19)25(28)31/h2-15H,16H2,1H3,(H,27,29)/b15-12- |
| InChIKey | VWEKVZVESSLPQE-QINSGFPZSA-N |
| XLogP | 3.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|