C20H18ClNO4 — CID 16570152
2-chloroprop-2-enyl 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 16570152) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is 2-chloroprop-2-enyl 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | 2-chloroprop-2-enyl 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 16570152 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-chloroprop-2-enyl 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | C=C(Cl)COC(=O)c1ccccc1NC(=O)/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H18ClNO4/c1-14(21)13-26-20(24)17-5-3-4-6-18(17)22-19(23)12-9-15-7-10-16(25-2)11-8-15/h3-12H,1,13H2,2H3,(H,22,23)/b12-9+ |
| InChIKey | AVNUIRLRQLRNPW-FMIVXFBMSA-N |
| XLogP | 4.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|