C23H21N3O5S — CID 34191949
[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 34191949) has the molecular formula C23H21N3O5S and a molecular weight of 451.50 g/mol. Its IUPAC name is [2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | [2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 34191949 |
| Molecular Formula | C23H21N3O5S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)OCC(=O)Nc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C23H21N3O5S/c1-15-14-32-23(24-15)26-21(28)13-31-22(29)18-5-3-4-6-19(18)25-20(27)12-9-16-7-10-17(30-2)11-8-16/h3-12,14H,13H2,1-2H3,(H,25,27)(H,24,26,28)/b12-9+ |
| InChIKey | RGYZFGBLIRCPST-FMIVXFBMSA-N |
| XLogP | 3.91 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|