C19H18N2O5 — CID 2593504
(2-amino-2-oxoethyl) 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 2593504) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | (2-amino-2-oxoethyl) 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 2593504 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2-amino-2-oxoethyl) 2-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccccc2C(=O)OCC(N)=O)cc1 |
| InChI | InChI=1S/C19H18N2O5/c1-25-14-9-6-13(7-10-14)8-11-18(23)21-16-5-3-2-4-15(16)19(24)26-12-17(20)22/h2-11H,12H2,1H3,(H2,20,22)(H,21,23)/b11-8+ |
| InChIKey | RMEOHENLCTXUGK-DHZHZOJOSA-N |
| XLogP | 1.99 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|