C24H21N3O4 — CID 17415387
2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[4-(4-methylphenoxy)phenyl]benzamide (PubChem CID 17415387) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[4-(4-methylphenoxy)phenyl]benzamide.
| Compound Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[4-(4-methylphenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 17415387 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[4-(4-methylphenoxy)phenyl]benzamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)c3ccccc3CN3C(=O)CNC3=O)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O4/c1-16-6-10-19(11-7-16)31-20-12-8-18(9-13-20)26-23(29)21-5-3-2-4-17(21)15-27-22(28)14-25-24(27)30/h2-13H,14-15H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | QDDIQPOSKBAMFH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|