C15H18N4O4 — CID 35052429
N-(2-acetamidoethyl)-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 35052429) has the molecular formula C15H18N4O4 and a molecular weight of 318.33 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-(2-acetamidoethyl)-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 35052429 |
| Molecular Formula | C15H18N4O4 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | CC(=O)NCCNC(=O)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C15H18N4O4/c1-10(20)16-6-7-17-14(22)12-5-3-2-4-11(12)9-19-13(21)8-18-15(19)23/h2-5H,6-9H2,1H3,(H,16,20)(H,17,22)(H,18,23) |
| InChIKey | SGSLKHLWNTWGTE-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|