C24H28N4O4 — CID 56555313
2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]benzamide (PubChem CID 56555313) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]benzamide.
| Compound Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 56555313 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(CN2CCC(O)CC2)cc1)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C24H28N4O4/c29-20-9-11-27(12-10-20)15-18-7-5-17(6-8-18)13-25-23(31)21-4-2-1-3-19(21)16-28-22(30)14-26-24(28)32/h1-8,20,29H,9-16H2,(H,25,31)(H,26,32) |
| InChIKey | SMGBMPSEUWTEGI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|