C19H19N3O3 — CID 17485480
4-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[(2-methylphenyl)methyl]benzamide (PubChem CID 17485480) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 4-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[(2-methylphenyl)methyl]benzamide.
| Compound Name | 4-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[(2-methylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 17485480 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 4-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[(2-methylphenyl)methyl]benzamide |
| SMILES | Cc1ccccc1CNC(=O)c1ccc(CN2C(=O)CNC2=O)cc1 |
| InChI | InChI=1S/C19H19N3O3/c1-13-4-2-3-5-16(13)10-20-18(24)15-8-6-14(7-9-15)12-22-17(23)11-21-19(22)25/h2-9H,10-12H2,1H3,(H,20,24)(H,21,25) |
| InChIKey | NHRREURTCJTQPU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|