C24H28N4O4 — CID 42893512
2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzamide (PubChem CID 42893512) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzamide.
| Compound Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 42893512 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]benzamide |
| SMILES | COc1ccccc1C(CNC(=O)c1ccccc1CN1C(=O)CNC1=O)N1CCCC1 |
| InChI | InChI=1S/C24H28N4O4/c1-32-21-11-5-4-10-19(21)20(27-12-6-7-13-27)14-25-23(30)18-9-3-2-8-17(18)16-28-22(29)15-26-24(28)31/h2-5,8-11,20H,6-7,12-16H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | ILHPWSADJOQORV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|