C25H30N4O6 — CID 32749513
N-[(2S)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide (PubChem CID 32749513) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[(2S)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide.
| Compound Name | N-[(2S)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 32749513 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | N-[(2S)-2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzamide |
| SMILES | COc1ccc([C@@H](CNC(=O)c2ccccc2CN2C(=O)CNC2=O)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C25H30N4O6/c1-33-21-8-7-17(13-22(21)34-2)20(28-9-11-35-12-10-28)14-26-24(31)19-6-4-3-5-18(19)16-29-23(30)15-27-25(29)32/h3-8,13,20H,9-12,14-16H2,1-2H3,(H,26,31)(H,27,32)/t20-/m1/s1 |
| InChIKey | BBCQPOVIGNADHH-HXUWFJFHSA-N |
| XLogP | 1.56 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|