C20H28N4O4 — CID 51648008
2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[[(2R)-4-(2-methylpropyl)morpholin-2-yl]methyl]benzamide (PubChem CID 51648008) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[[(2R)-4-(2-methylpropyl)morpholin-2-yl]methyl]benzamide.
| Compound Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[[(2R)-4-(2-methylpropyl)morpholin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 51648008 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[[(2R)-4-(2-methylpropyl)morpholin-2-yl]methyl]benzamide |
| SMILES | CC(C)CN1CCO[C@H](CNC(=O)c2ccccc2CN2C(=O)CNC2=O)C1 |
| InChI | InChI=1S/C20H28N4O4/c1-14(2)11-23-7-8-28-16(13-23)9-21-19(26)17-6-4-3-5-15(17)12-24-18(25)10-22-20(24)27/h3-6,14,16H,7-13H2,1-2H3,(H,21,26)(H,22,27)/t16-/m1/s1 |
| InChIKey | BYQRTEOIKOQYNN-MRXNPFEDSA-N |
| XLogP | 0.82 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|