C18H19N3O3S2 — CID 24643529
2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 24643529) has the molecular formula C18H19N3O3S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 24643529 |
| Molecular Formula | C18H19N3O3S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-[(2,5-dioxoimidazolidin-1-yl)methyl]-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSCc1ccsc1)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C18H19N3O3S2/c22-16-9-20-18(24)21(16)10-14-3-1-2-4-15(14)17(23)19-6-8-26-12-13-5-7-25-11-13/h1-5,7,11H,6,8-10,12H2,(H,19,23)(H,20,24) |
| InChIKey | QLECDBJZXDKDJW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|