C15H17N3O3S2 — CID 24532862
2-(methylamino)-5-nitro-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]benzamide (PubChem CID 24532862) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-(methylamino)-5-nitro-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]benzamide.
| Compound Name | 2-(methylamino)-5-nitro-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 24532862 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 2-(methylamino)-5-nitro-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]benzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)NCCSCc1ccsc1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-16-14-3-2-12(18(20)21)8-13(14)15(19)17-5-7-23-10-11-4-6-22-9-11/h2-4,6,8-9,16H,5,7,10H2,1H3,(H,17,19) |
| InChIKey | BZQACYRLNUIMNN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|