C12H15F2N3O4 — CID 103097014
N-[2-(2,2-difluoroethoxy)ethyl]-2-(methylamino)-5-nitrobenzamide (PubChem CID 103097014) has the molecular formula C12H15F2N3O4 and a molecular weight of 303.27 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-2-(methylamino)-5-nitrobenzamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(methylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 103097014 |
| Molecular Formula | C12H15F2N3O4 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-2-(methylamino)-5-nitrobenzamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)NCCOCC(F)F |
| InChI | InChI=1S/C12H15F2N3O4/c1-15-10-3-2-8(17(19)20)6-9(10)12(18)16-4-5-21-7-11(13)14/h2-3,6,11,15H,4-5,7H2,1H3,(H,16,18) |
| InChIKey | BJVHKOPEPFLUGE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|