C11H11ClF2N2O4 — CID 103082387
2-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-5-nitrobenzamide (PubChem CID 103082387) has the molecular formula C11H11ClF2N2O4 and a molecular weight of 308.67 g/mol. Its IUPAC name is 2-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 103082387 |
| Molecular Formula | C11H11ClF2N2O4 |
| Molecular Weight | 308.67 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-5-nitrobenzamide |
| SMILES | O=C(NCCOCC(F)F)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C11H11ClF2N2O4/c12-9-2-1-7(16(18)19)5-8(9)11(17)15-3-4-20-6-10(13)14/h1-2,5,10H,3-4,6H2,(H,15,17) |
| InChIKey | PNNPIMNNLWKFMZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.67 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|