C13H15FN2O4 — CID 115700390
2-fluoro-N-[2-(2-methylprop-2-enoxy)ethyl]-5-nitrobenzamide (PubChem CID 115700390) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 2-fluoro-N-[2-(2-methylprop-2-enoxy)ethyl]-5-nitrobenzamide.
| Compound Name | 2-fluoro-N-[2-(2-methylprop-2-enoxy)ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 115700390 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-fluoro-N-[2-(2-methylprop-2-enoxy)ethyl]-5-nitrobenzamide |
| SMILES | C=C(C)COCCNC(=O)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C13H15FN2O4/c1-9(2)8-20-6-5-15-13(17)11-7-10(16(18)19)3-4-12(11)14/h3-4,7H,1,5-6,8H2,2H3,(H,15,17) |
| InChIKey | DNWLBVRZDBUXDP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|