C11H12BrN3O5 — CID 106235460
N-[2-(2-amino-2-oxoethoxy)ethyl]-2-bromo-5-nitrobenzamide (PubChem CID 106235460) has the molecular formula C11H12BrN3O5 and a molecular weight of 346.14 g/mol. Its IUPAC name is N-[2-(2-amino-2-oxoethoxy)ethyl]-2-bromo-5-nitrobenzamide.
| Compound Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-2-bromo-5-nitrobenzamide |
|---|---|
| PubChem CID | 106235460 |
| Molecular Formula | C11H12BrN3O5 |
| Molecular Weight | 346.14 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | N-[2-(2-amino-2-oxoethoxy)ethyl]-2-bromo-5-nitrobenzamide |
| SMILES | NC(=O)COCCNC(=O)c1cc([N+](=O)[O-])ccc1Br |
| InChI | InChI=1S/C11H12BrN3O5/c12-9-2-1-7(15(18)19)5-8(9)11(17)14-3-4-20-6-10(13)16/h1-2,5H,3-4,6H2,(H2,13,16)(H,14,17) |
| InChIKey | DRYPQXWHYWFHML-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|