C21H23N3O2S4 — CID 39044507
2-N,6-N-bis[2-(thiophen-3-ylmethylsulfanyl)ethyl]pyridine-2,6-dicarboxamide (PubChem CID 39044507) has the molecular formula C21H23N3O2S4 and a molecular weight of 477.70 g/mol. Its IUPAC name is 2-N,6-N-bis[2-(thiophen-3-ylmethylsulfanyl)ethyl]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[2-(thiophen-3-ylmethylsulfanyl)ethyl]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 39044507 |
| Molecular Formula | C21H23N3O2S4 |
| Molecular Weight | 477.70 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2-N,6-N-bis[2-(thiophen-3-ylmethylsulfanyl)ethyl]pyridine-2,6-dicarboxamide |
| SMILES | O=C(NCCSCc1ccsc1)c1cccc(C(=O)NCCSCc2ccsc2)n1 |
| InChI | InChI=1S/C21H23N3O2S4/c25-20(22-6-10-29-14-16-4-8-27-12-16)18-2-1-3-19(24-18)21(26)23-7-11-30-15-17-5-9-28-13-17/h1-5,8-9,12-13H,6-7,10-11,14-15H2,(H,22,25)(H,23,26) |
| InChIKey | XQVJSAFAGCDNPI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.70 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|