C22H21N3O2S3 — CID 24551791
2-benzyl-5-methyl-4-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-3H-thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 24551791) has the molecular formula C22H21N3O2S3 and a molecular weight of 455.63 g/mol. Its IUPAC name is 2-benzyl-5-methyl-4-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-3H-thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-benzyl-5-methyl-4-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-3H-thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 24551791 |
| Molecular Formula | C22H21N3O2S3 |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 2-benzyl-5-methyl-4-oxo-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-3H-thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NCCSCc2ccsc2)sc2nc(Cc3ccccc3)[nH]c(=O)c12 |
| InChI | InChI=1S/C22H21N3O2S3/c1-14-18-20(26)24-17(11-15-5-3-2-4-6-15)25-22(18)30-19(14)21(27)23-8-10-29-13-16-7-9-28-12-16/h2-7,9,12H,8,10-11,13H2,1H3,(H,23,27)(H,24,25,26) |
| InChIKey | QRIKXVNFBAYHOS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|