C19H21N3OS2 — CID 43044020
N-(2-benzylsulfanylethyl)-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 43044020) has the molecular formula C19H21N3OS2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-(2-benzylsulfanylethyl)-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(2-benzylsulfanylethyl)-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 43044020 |
| Molecular Formula | C19H21N3OS2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | N-(2-benzylsulfanylethyl)-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc(C)c2c(C)c(C(=O)NCCSCc3ccccc3)sc2n1 |
| InChI | InChI=1S/C19H21N3OS2/c1-12-16-13(2)21-14(3)22-19(16)25-17(12)18(23)20-9-10-24-11-15-7-5-4-6-8-15/h4-8H,9-11H2,1-3H3,(H,20,23) |
| InChIKey | ZSNBHCLROWZTCP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|