C18H18ClN3O2S — CID 33282949
N-[2-(4-chlorophenoxy)ethyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 33282949) has the molecular formula C18H18ClN3O2S and a molecular weight of 375.88 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 33282949 |
| Molecular Formula | C18H18ClN3O2S |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-2,4,5-trimethylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc(C)c2c(C)c(C(=O)NCCOc3ccc(Cl)cc3)sc2n1 |
| InChI | InChI=1S/C18H18ClN3O2S/c1-10-15-11(2)21-12(3)22-18(15)25-16(10)17(23)20-8-9-24-14-6-4-13(19)5-7-14/h4-7H,8-9H2,1-3H3,(H,20,23) |
| InChIKey | ALEXDJPJAISCIU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|