C11H12N4OS — CID 63248051
6-hydrazinyl-N-(thiophen-3-ylmethyl)pyridine-2-carboxamide (PubChem CID 63248051) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is 6-hydrazinyl-N-(thiophen-3-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 6-hydrazinyl-N-(thiophen-3-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63248051 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 6-hydrazinyl-N-(thiophen-3-ylmethyl)pyridine-2-carboxamide |
| SMILES | NNc1cccc(C(=O)NCc2ccsc2)n1 |
| InChI | InChI=1S/C11H12N4OS/c12-15-10-3-1-2-9(14-10)11(16)13-6-8-4-5-17-7-8/h1-5,7H,6,12H2,(H,13,16)(H,14,15) |
| InChIKey | NYQPHUPEJLUIIO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|