C17H17N3O2S3 — CID 24551793
3-methyl-4-oxo-2-sulfanylidene-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-1H-quinazoline-7-carboxamide (PubChem CID 24551793) has the molecular formula C17H17N3O2S3 and a molecular weight of 391.54 g/mol. Its IUPAC name is 3-methyl-4-oxo-2-sulfanylidene-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-1H-quinazoline-7-carboxamide.
| Compound Name | 3-methyl-4-oxo-2-sulfanylidene-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 24551793 |
| Molecular Formula | C17H17N3O2S3 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 3-methyl-4-oxo-2-sulfanylidene-N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-1H-quinazoline-7-carboxamide |
| SMILES | Cn1c(=S)[nH]c2cc(C(=O)NCCSCc3ccsc3)ccc2c1=O |
| InChI | InChI=1S/C17H17N3O2S3/c1-20-16(22)13-3-2-12(8-14(13)19-17(20)23)15(21)18-5-7-25-10-11-4-6-24-9-11/h2-4,6,8-9H,5,7,10H2,1H3,(H,18,21)(H,19,23) |
| InChIKey | WYOJDPPAQXVXJN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|