C23H27N3O3S2 — CID 55415012
3-(3-methoxypropyl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 55415012) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-(3-methoxypropyl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55415012 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-(3-methoxypropyl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)NCCSCc3ccc(C)cc3)ccc2c1=O |
| InChI | InChI=1S/C23H27N3O3S2/c1-16-4-6-17(7-5-16)15-31-13-10-24-21(27)18-8-9-19-20(14-18)25-23(30)26(22(19)28)11-3-12-29-2/h4-9,14H,3,10-13,15H2,1-2H3,(H,24,27)(H,25,30) |
| InChIKey | CFGNHLNVPRRDKQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|