C22H22N6O3S — CID 55735801
3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-1H-quinazoline-7-carboxamide (PubChem CID 55735801) has the molecular formula C22H22N6O3S and a molecular weight of 450.52 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-1H-quinazoline-7-carboxamide.
| Compound Name | 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55735801 |
| Molecular Formula | C22H22N6O3S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]-1H-quinazoline-7-carboxamide |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)NCc3ccc(-n4cncn4)cc3)ccc2c1=O |
| InChI | InChI=1S/C22H22N6O3S/c1-31-10-2-9-27-21(30)18-8-5-16(11-19(18)26-22(27)32)20(29)24-12-15-3-6-17(7-4-15)28-14-23-13-25-28/h3-8,11,13-14H,2,9-10,12H2,1H3,(H,24,29)(H,26,32) |
| InChIKey | ZMUTZJCGSNTFKI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|