C21H21Cl2N3O3S — CID 45353199
N-[1-(3,4-dichlorophenyl)ethyl]-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 45353199) has the molecular formula C21H21Cl2N3O3S and a molecular weight of 466.39 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 45353199 |
| Molecular Formula | C21H21Cl2N3O3S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)NC(C)c3ccc(Cl)c(Cl)c3)ccc2c1=O |
| InChI | InChI=1S/C21H21Cl2N3O3S/c1-12(13-5-7-16(22)17(23)10-13)24-19(27)14-4-6-15-18(11-14)25-21(30)26(20(15)28)8-3-9-29-2/h4-7,10-12H,3,8-9H2,1-2H3,(H,24,27)(H,25,30) |
| InChIKey | ZWRXIQNFOSCJHP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|