C24H24FN5O3S — CID 55461538
N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 55461538) has the molecular formula C24H24FN5O3S and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55461538 |
| Molecular Formula | C24H24FN5O3S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)NC(c3ccc(F)cc3)c3nccn3C)ccc2c1=O |
| InChI | InChI=1S/C24H24FN5O3S/c1-29-12-10-26-21(29)20(15-4-7-17(25)8-5-15)28-22(31)16-6-9-18-19(14-16)27-24(34)30(23(18)32)11-3-13-33-2/h4-10,12,14,20H,3,11,13H2,1-2H3,(H,27,34)(H,28,31) |
| InChIKey | NCNKZESNYOHVCW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|