C24H28N4O4S — CID 46564218
3-(3-methoxypropyl)-4-oxo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 46564218) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-4-oxo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | 3-(3-methoxypropyl)-4-oxo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 46564218 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-(3-methoxypropyl)-4-oxo-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)NCC(=O)Nc3c(C)cc(C)cc3C)ccc2c1=O |
| InChI | InChI=1S/C24H28N4O4S/c1-14-10-15(2)21(16(3)11-14)27-20(29)13-25-22(30)17-6-7-18-19(12-17)26-24(33)28(23(18)31)8-5-9-32-4/h6-7,10-12H,5,8-9,13H2,1-4H3,(H,25,30)(H,26,33)(H,27,29) |
| InChIKey | LRYHZNPQSVUHPP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|