C20H18F3N3O4S — CID 25380763
3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-N-[4-(trifluoromethoxy)phenyl]-1H-quinazoline-7-carboxamide (PubChem CID 25380763) has the molecular formula C20H18F3N3O4S and a molecular weight of 453.44 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-N-[4-(trifluoromethoxy)phenyl]-1H-quinazoline-7-carboxamide.
| Compound Name | 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-N-[4-(trifluoromethoxy)phenyl]-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 25380763 |
| Molecular Formula | C20H18F3N3O4S |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-N-[4-(trifluoromethoxy)phenyl]-1H-quinazoline-7-carboxamide |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)Nc3ccc(OC(F)(F)F)cc3)ccc2c1=O |
| InChI | InChI=1S/C20H18F3N3O4S/c1-29-10-2-9-26-18(28)15-8-3-12(11-16(15)25-19(26)31)17(27)24-13-4-6-14(7-5-13)30-20(21,22)23/h3-8,11H,2,9-10H2,1H3,(H,24,27)(H,25,31) |
| InChIKey | BQFJYAOWYSMNOF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|