C22H20FN5O3S — CID 55955786
N-(3-fluoro-4-imidazol-1-ylphenyl)-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 55955786) has the molecular formula C22H20FN5O3S and a molecular weight of 453.50 g/mol. Its IUPAC name is N-(3-fluoro-4-imidazol-1-ylphenyl)-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 55955786 |
| Molecular Formula | C22H20FN5O3S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | N-(3-fluoro-4-imidazol-1-ylphenyl)-3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)Nc3ccc(-n4ccnc4)c(F)c3)ccc2c1=O |
| InChI | InChI=1S/C22H20FN5O3S/c1-31-10-2-8-28-21(30)16-5-3-14(11-18(16)26-22(28)32)20(29)25-15-4-6-19(17(23)12-15)27-9-7-24-13-27/h3-7,9,11-13H,2,8,10H2,1H3,(H,25,29)(H,26,32) |
| InChIKey | JTYUQEJDHOWPNR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|