C16H17NOS3 — CID 18139065
N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 18139065) has the molecular formula C16H17NOS3 and a molecular weight of 335.52 g/mol. Its IUPAC name is N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-2,3-dihydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 18139065 |
| Molecular Formula | C16H17NOS3 |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[2-(thiophen-3-ylmethylsulfanyl)ethyl]-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NCCSCc1ccsc1)C1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H17NOS3/c18-16(15-9-13-3-1-2-4-14(13)21-15)17-6-8-20-11-12-5-7-19-10-12/h1-5,7,10,15H,6,8-9,11H2,(H,17,18) |
| InChIKey | DUPRYCPZPJFDEG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|