C16H20N2S3 — CID 8563110
1-(2,3-dimethylphenyl)-3-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiourea (PubChem CID 8563110) has the molecular formula C16H20N2S3 and a molecular weight of 336.55 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8563110 |
| Molecular Formula | C16H20N2S3 |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiourea |
| SMILES | Cc1cccc(NC(=S)NCCSCc2ccsc2)c1C |
| InChI | InChI=1S/C16H20N2S3/c1-12-4-3-5-15(13(12)2)18-16(19)17-7-9-21-11-14-6-8-20-10-14/h3-6,8,10H,7,9,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | DFUYVCPRBAYRBU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|