C15H18N2OS3 — CID 8563087
1-(4-methoxyphenyl)-3-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiourea (PubChem CID 8563087) has the molecular formula C15H18N2OS3 and a molecular weight of 338.52 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8563087 |
| Molecular Formula | C15H18N2OS3 |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[2-(thiophen-3-ylmethylsulfanyl)ethyl]thiourea |
| SMILES | COc1ccc(NC(=S)NCCSCc2ccsc2)cc1 |
| InChI | InChI=1S/C15H18N2OS3/c1-18-14-4-2-13(3-5-14)17-15(19)16-7-9-21-11-12-6-8-20-10-12/h2-6,8,10H,7,9,11H2,1H3,(H2,16,17,19) |
| InChIKey | YMJYLJAQTCBSNE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|