C10H11F3N2OS — CID 143565339
1-(4-methoxyphenyl)-3-(2,2,2-trifluoroethyl)thiourea (PubChem CID 143565339) has the molecular formula C10H11F3N2OS and a molecular weight of 264.27 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(2,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-(2,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 143565339 |
| Molecular Formula | C10H11F3N2OS |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(2,2,2-trifluoroethyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3N2OS/c1-16-8-4-2-7(3-5-8)15-9(17)14-6-10(11,12)13/h2-5H,6H2,1H3,(H2,14,15,17) |
| InChIKey | YLMVMBWBGUGZKD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|