C15H25N3OS — CID 2423857
1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 2423857) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2423857 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCC(C)(C)CN(C)C)cc1 |
| InChI | InChI=1S/C15H25N3OS/c1-15(2,11-18(3)4)10-16-14(20)17-12-6-8-13(19-5)9-7-12/h6-9H,10-11H2,1-5H3,(H2,16,17,20) |
| InChIKey | WGAQBMUMAWTVRC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|