C11H25N3OS — CID 115570241
1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(2-methoxyethyl)thiourea (PubChem CID 115570241) has the molecular formula C11H25N3OS and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 115570241 |
| Molecular Formula | C11H25N3OS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-[3-(dimethylamino)-2,2-dimethylpropyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCC(C)(C)CN(C)C |
| InChI | InChI=1S/C11H25N3OS/c1-11(2,9-14(3)4)8-13-10(16)12-6-7-15-5/h6-9H2,1-5H3,(H2,12,13,16) |
| InChIKey | GIFSIBZNOYTYJB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|