C8H17N3O3S — CID 2205112
1-[(2-hydroxy-2-methylpropanoyl)amino]-3-(2-methoxyethyl)thiourea (PubChem CID 2205112) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-[(2-hydroxy-2-methylpropanoyl)amino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[(2-hydroxy-2-methylpropanoyl)amino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 2205112 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-[(2-hydroxy-2-methylpropanoyl)amino]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NNC(=O)C(C)(C)O |
| InChI | InChI=1S/C8H17N3O3S/c1-8(2,13)6(12)10-11-7(15)9-4-5-14-3/h13H,4-5H2,1-3H3,(H,10,12)(H2,9,11,15) |
| InChIKey | CECVNXAQGMABOO-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|