C8H14N4O2S — CID 2803600
1-[(2-cyanoacetyl)amino]-3-(3-methoxypropyl)thiourea (PubChem CID 2803600) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-[(2-cyanoacetyl)amino]-3-(3-methoxypropyl)thiourea.
| Compound Name | 1-[(2-cyanoacetyl)amino]-3-(3-methoxypropyl)thiourea |
|---|---|
| PubChem CID | 2803600 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-[(2-cyanoacetyl)amino]-3-(3-methoxypropyl)thiourea |
| SMILES | COCCCNC(=S)NNC(=O)CC#N |
| InChI | InChI=1S/C8H14N4O2S/c1-14-6-2-5-10-8(15)12-11-7(13)3-4-9/h2-3,5-6H2,1H3,(H,11,13)(H2,10,12,15) |
| InChIKey | LWBCKKVWOKOIJO-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|