C14H17F4N3O3S — CID 4867020
1-(3-methoxypropyl)-3-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]thiourea (PubChem CID 4867020) has the molecular formula C14H17F4N3O3S and a molecular weight of 383.37 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]thiourea.
| Compound Name | 1-(3-methoxypropyl)-3-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 4867020 |
| Molecular Formula | C14H17F4N3O3S |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-(3-methoxypropyl)-3-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]thiourea |
| SMILES | COCCCNC(=S)NNC(=O)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C14H17F4N3O3S/c1-23-7-3-6-19-13(25)21-20-11(22)9-4-2-5-10(8-9)24-14(17,18)12(15)16/h2,4-5,8,12H,3,6-7H2,1H3,(H,20,22)(H2,19,21,25) |
| InChIKey | DEUITVUJILCYDN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|