C12H12F4O2 — CID 91658409
1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one (PubChem CID 91658409) has the molecular formula C12H12F4O2 and a molecular weight of 264.22 g/mol. Its IUPAC name is 1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one.
| Compound Name | 1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one |
|---|---|
| PubChem CID | 91658409 |
| Molecular Formula | C12H12F4O2 |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butan-1-one |
| SMILES | CCCC(=O)c1cccc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H12F4O2/c1-2-4-10(17)8-5-3-6-9(7-8)18-12(15,16)11(13)14/h3,5-7,11H,2,4H2,1H3 |
| InChIKey | QBHCGORJTKHTGN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|