About (3-butanoylphenyl) benzoate
(3-butanoylphenyl) benzoate (PubChem CID 141249962) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is (3-butanoylphenyl) benzoate.
Molecular Properties
| Compound Name | (3-butanoylphenyl) benzoate |
| PubChem CID | 141249962 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (3-butanoylphenyl) benzoate |
| SMILES | CCCC(=O)c1cccc(OC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H16O3/c1-2-7-16(18)14-10-6-11-15(12-14)20-17(19)13-8-4-3-5-9-13/h3-6,8-12H,2,7H2,1H3 |
| InChIKey | BUSYNZWGEMPJHZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-butanoylphenyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butanoylphenyl) benzoate?
The IUPAC name of (3-butanoylphenyl) benzoate (CID 141249962) is (3-butanoylphenyl) benzoate.
What is the SMILES notation for (3-butanoylphenyl) benzoate?
The canonical SMILES for (3-butanoylphenyl) benzoate is CCCC(=O)c1cccc(OC(=O)c2ccccc2)c1.
What is the InChIKey of (3-butanoylphenyl) benzoate?
The InChIKey is BUSYNZWGEMPJHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c1-2-7-16(18)14-10-6-11-15(12-14)20-17(19)13-8-4-3-5-9-13/h3-6,8-12H,2,7H2,1H3.
What are the key properties of (3-butanoylphenyl) benzoate?
(3-butanoylphenyl) benzoate has a molecular weight of 268.31 g/mol, XLogP of 3.89, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butanoylphenyl) benzoate is sourced from PubChem (CID 141249962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).